C31H37F2N4O12P — CID 126731144
propan-2-yl (2R)-2-[[[(2R,3R)-4,4-difluoro-3-hydroxy-5-[2-oxo-4-[(2,4,6-trimethoxybenzoyl)amino]pyrimidin-1-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 126731144) has the molecular formula C31H37F2N4O12P and a molecular weight of 726.62 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R)-4,4-difluoro-3-hydroxy-5-[2-oxo-4-[(2,4,6-trimethoxybenzoyl)amino]pyrimidin-1-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R)-4,4-difluoro-3-hydroxy-5-[2-oxo-4-[(2,4,6-trimethoxybenzoyl)amino]pyrimidin-1-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126731144 |
| Molecular Formula | C31H37F2N4O12P |
| Molecular Weight | 726.62 g/mol |
| Exact Mass | 726.21 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R)-4,4-difluoro-3-hydroxy-5-[2-oxo-4-[(2,4,6-trimethoxybenzoyl)amino]pyrimidin-1-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COc1cc(OC)c(C(=O)Nc2ccn(C3O[C@H](COP(=O)(N[C@H](C)C(=O)OC(C)C)Oc4ccccc4)[C@@H](O)C3(F)F)c(=O)n2)c(OC)c1 |
| InChI | InChI=1S/C31H37F2N4O12P/c1-17(2)47-28(40)18(3)36-50(42,49-19-10-8-7-9-11-19)46-16-23-26(38)31(32,33)29(48-23)37-13-12-24(35-30(37)41)34-27(39)25-21(44-5)14-20(43-4)15-22(25)45-6/h7-15,17-18,23,26,29,38H,16H2,1-6H3,(H,36,42)(H,34,35,39,41)/t18-,23-,26-,29?,50?/m1/s1 |
| InChIKey | CMIXYHNRZMKYTN-VGDTXKOPSA-N |
| XLogP | 3.55 |
| TPSA | 195.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.62 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|