C14H14ClF4NO — CID 126733096
(5S)-3-[3-chloro-2-fluoro-5-(trifluoromethyl)phenoxy]-8-azabicyclo[3.2.1]octane (PubChem CID 126733096) has the molecular formula C14H14ClF4NO and a molecular weight of 323.72 g/mol. Its IUPAC name is (5S)-3-[3-chloro-2-fluoro-5-(trifluoromethyl)phenoxy]-8-azabicyclo[3.2.1]octane.
| Compound Name | (5S)-3-[3-chloro-2-fluoro-5-(trifluoromethyl)phenoxy]-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 126733096 |
| Molecular Formula | C14H14ClF4NO |
| Molecular Weight | 323.72 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | (5S)-3-[3-chloro-2-fluoro-5-(trifluoromethyl)phenoxy]-8-azabicyclo[3.2.1]octane |
| SMILES | Fc1c(Cl)cc(C(F)(F)F)cc1OC1CC2CC[C@@H](C1)N2 |
| InChI | InChI=1S/C14H14ClF4NO/c15-11-3-7(14(17,18)19)4-12(13(11)16)21-10-5-8-1-2-9(6-10)20-8/h3-4,8-10,20H,1-2,5-6H2/t8-,9?,10?/m0/s1 |
| InChIKey | GPLUTHIIKNKABR-IDKOKCKLSA-N |
| XLogP | 4.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.72 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |