C34H48N4O9S — CID 126734148
2,4-dioxatricyclo[4.3.1.03,8]decan-10-yl N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-[2,2-dimethyl-5-(methylcarbamoyloxy)pentyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 126734148) has the molecular formula C34H48N4O9S and a molecular weight of 688.84 g/mol. Its IUPAC name is 2,4-dioxatricyclo[4.3.1.03,8]decan-10-yl N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-[2,2-dimethyl-5-(methylcarbamoyloxy)pentyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,4-dioxatricyclo[4.3.1.03,8]decan-10-yl N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-[2,2-dimethyl-5-(methylcarbamoyloxy)pentyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 126734148 |
| Molecular Formula | C34H48N4O9S |
| Molecular Weight | 688.84 g/mol |
| Exact Mass | 688.31 |
| IUPAC Name | 2,4-dioxatricyclo[4.3.1.03,8]decan-10-yl N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-[2,2-dimethyl-5-(methylcarbamoyloxy)pentyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CNC(=O)OCCCC(C)(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC1C2COC3OC1CC3C2)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C34H48N4O9S/c1-34(2,14-7-15-44-32(40)36-3)21-38(48(42,43)26-12-10-25(35)11-13-26)19-28(39)27(16-22-8-5-4-6-9-22)37-33(41)47-30-24-17-23-18-29(30)46-31(23)45-20-24/h4-6,8-13,23-24,27-31,39H,7,14-21,35H2,1-3H3,(H,36,40)(H,37,41)/t23?,24?,27-,28+,29?,30?,31?/m0/s1 |
| InChIKey | CXJFBTBQDVRTKK-PCOIWBPSSA-N |
| XLogP | 3.27 |
| TPSA | 178.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.84 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|