C24H32N2O — CID 126735106
3-(1H-indol-3-yl)-4-methyl-1-(4-methyl-3,5,6,7,8,8a-hexahydro-2H-quinolin-1-yl)pentan-1-one (PubChem CID 126735106) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-4-methyl-1-(4-methyl-3,5,6,7,8,8a-hexahydro-2H-quinolin-1-yl)pentan-1-one.
| Compound Name | 3-(1H-indol-3-yl)-4-methyl-1-(4-methyl-3,5,6,7,8,8a-hexahydro-2H-quinolin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 126735106 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 3-(1H-indol-3-yl)-4-methyl-1-(4-methyl-3,5,6,7,8,8a-hexahydro-2H-quinolin-1-yl)pentan-1-one |
| SMILES | CC1=C2CCCCC2N(C(=O)CC(c2c[nH]c3ccccc23)C(C)C)CC1 |
| InChI | InChI=1S/C24H32N2O/c1-16(2)20(21-15-25-22-10-6-4-9-19(21)22)14-24(27)26-13-12-17(3)18-8-5-7-11-23(18)26/h4,6,9-10,15-16,20,23,25H,5,7-8,11-14H2,1-3H3 |
| InChIKey | ARFHRPNXTPQDHI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|