C37H38F3N5O6 — CID 126738320
1-N-[3-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-[4-[4-(propanoylamino)piperidin-1-yl]-3-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 126738320) has the molecular formula C37H38F3N5O6 and a molecular weight of 705.73 g/mol. Its IUPAC name is 1-N-[3-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-[4-[4-(propanoylamino)piperidin-1-yl]-3-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[3-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-[4-[4-(propanoylamino)piperidin-1-yl]-3-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 126738320 |
| Molecular Formula | C37H38F3N5O6 |
| Molecular Weight | 705.73 g/mol |
| Exact Mass | 705.28 |
| IUPAC Name | 1-N-[3-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-[4-[4-(propanoylamino)piperidin-1-yl]-3-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | CCC(=O)NC1CCN(c2ccc(NC(=O)C3(C(=O)Nc4cccc(Oc5ccnc6cc(OC)c(OC)cc56)c4)CC3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C37H38F3N5O6/c1-4-33(46)42-22-11-16-45(17-12-22)29-9-8-24(19-27(29)37(38,39)40)44-35(48)36(13-14-36)34(47)43-23-6-5-7-25(18-23)51-30-10-15-41-28-21-32(50-3)31(49-2)20-26(28)30/h5-10,15,18-22H,4,11-14,16-17H2,1-3H3,(H,42,46)(H,43,47)(H,44,48) |
| InChIKey | NUZOHCUWVOWXRV-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.73 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|