C29H49NO2 — CID 126738567
(3R,10R,13R,14R,17S)-13-amino-17-[(Z)-7-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,14-tetramethyl-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 126738567) has the molecular formula C29H49NO2 and a molecular weight of 443.72 g/mol. Its IUPAC name is (3R,10R,13R,14R,17S)-13-amino-17-[(Z)-7-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,14-tetramethyl-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,10R,13R,14R,17S)-13-amino-17-[(Z)-7-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,14-tetramethyl-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 126738567 |
| Molecular Formula | C29H49NO2 |
| Molecular Weight | 443.72 g/mol |
| Exact Mass | 443.38 |
| IUPAC Name | (3R,10R,13R,14R,17S)-13-amino-17-[(Z)-7-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,14-tetramethyl-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C/C(=C/CCC(C)[C@@H]1CC[C@]2(C)C3=CCC4C(C)(C)[C@H](O)CC[C@]4(C)C3CC[C@@]12N)CO |
| InChI | InChI=1S/C29H49NO2/c1-19(18-31)8-7-9-20(2)21-12-16-28(6)23-10-11-24-26(3,4)25(32)14-15-27(24,5)22(23)13-17-29(21,28)30/h8,10,20-22,24-25,31-32H,7,9,11-18,30H2,1-6H3/b19-8-/t20?,21-,22?,24?,25+,27+,28+,29+/m0/s1 |
| InChIKey | DPGRDSJESKZRCR-AYXBJPIPSA-N |
| XLogP | 6.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.72 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|