C10H15NO2 — CID 12673904
2-cyano-2-(1-methylcyclohexyl)acetic acid (PubChem CID 12673904) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 2-cyano-2-(1-methylcyclohexyl)acetic acid.
| Compound Name | 2-cyano-2-(1-methylcyclohexyl)acetic acid |
|---|---|
| PubChem CID | 12673904 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 2-cyano-2-(1-methylcyclohexyl)acetic acid |
| SMILES | CC1(C(C#N)C(=O)O)CCCCC1 |
| InChI | InChI=1S/C10H15NO2/c1-10(5-3-2-4-6-10)8(7-11)9(12)13/h8H,2-6H2,1H3,(H,12,13) |
| InChIKey | MAJFAUMDJVSGSV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |