C20H28FNO4 — CID 126740934
tert-butyl 2-(3-fluorophenyl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate (PubChem CID 126740934) has the molecular formula C20H28FNO4 and a molecular weight of 365.45 g/mol. Its IUPAC name is tert-butyl 2-(3-fluorophenyl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate.
| Compound Name | tert-butyl 2-(3-fluorophenyl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 126740934 |
| Molecular Formula | C20H28FNO4 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | tert-butyl 2-(3-fluorophenyl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(O)CC(c1cccc(F)c1)O2 |
| InChI | InChI=1S/C20H28FNO4/c1-19(2,3)26-18(24)22-9-7-20(8-10-22)13-16(23)12-17(25-20)14-5-4-6-15(21)11-14/h4-6,11,16-17,23H,7-10,12-13H2,1-3H3 |
| InChIKey | HPHLKZNBXCKROS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |