C16H24N2O2 — CID 126741056
(2R,4R)-4-ethoxy-2-pyridin-3-yl-1-oxa-9-azaspiro[5.5]undecane (PubChem CID 126741056) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2R,4R)-4-ethoxy-2-pyridin-3-yl-1-oxa-9-azaspiro[5.5]undecane.
| Compound Name | (2R,4R)-4-ethoxy-2-pyridin-3-yl-1-oxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 126741056 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (2R,4R)-4-ethoxy-2-pyridin-3-yl-1-oxa-9-azaspiro[5.5]undecane |
| SMILES | CCO[C@@H]1C[C@H](c2cccnc2)OC2(CCNCC2)C1 |
| InChI | InChI=1S/C16H24N2O2/c1-2-19-14-10-15(13-4-3-7-18-12-13)20-16(11-14)5-8-17-9-6-16/h3-4,7,12,14-15,17H,2,5-6,8-11H2,1H3/t14-,15-/m1/s1 |
| InChIKey | ZHWLEIFJQTWHBY-HUUCEWRRSA-N |
| XLogP | 2.46 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |