C28H31N5O3 — CID 126741547
ethyl 3-cyclobutyl-4-[6-(3-methoxypropylamino)-3-pyridinyl]-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylate (PubChem CID 126741547) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is ethyl 3-cyclobutyl-4-[6-(3-methoxypropylamino)-3-pyridinyl]-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylate.
| Compound Name | ethyl 3-cyclobutyl-4-[6-(3-methoxypropylamino)-3-pyridinyl]-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 126741547 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | ethyl 3-cyclobutyl-4-[6-(3-methoxypropylamino)-3-pyridinyl]-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(NCCCOC)nc2)c2c(C3CCC3)nn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C28H31N5O3/c1-3-36-28(34)23-17-22(20-13-14-24(30-18-20)29-15-8-16-35-2)25-26(19-9-7-10-19)32-33(27(25)31-23)21-11-5-4-6-12-21/h4-6,11-14,17-19H,3,7-10,15-16H2,1-2H3,(H,29,30) |
| InChIKey | OEQSCTUXGFRIMY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|