C25H31FN4O3 — CID 129030582
3-cyclobutyl-4-[3-fluoropropyl(4-methoxybutyl)amino]-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylic acid (PubChem CID 129030582) has the molecular formula C25H31FN4O3 and a molecular weight of 454.55 g/mol. Its IUPAC name is 3-cyclobutyl-4-[3-fluoropropyl(4-methoxybutyl)amino]-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylic acid.
| Compound Name | 3-cyclobutyl-4-[3-fluoropropyl(4-methoxybutyl)amino]-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 129030582 |
| Molecular Formula | C25H31FN4O3 |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 3-cyclobutyl-4-[3-fluoropropyl(4-methoxybutyl)amino]-1-phenylpyrazolo[5,4-b]pyridine-6-carboxylic acid |
| SMILES | COCCCCN(CCCF)c1cc(C(=O)O)nc2c1c(C1CCC1)nn2-c1ccccc1 |
| InChI | InChI=1S/C25H31FN4O3/c1-33-16-6-5-14-29(15-8-13-26)21-17-20(25(31)32)27-24-22(21)23(18-9-7-10-18)28-30(24)19-11-3-2-4-12-19/h2-4,11-12,17-18H,5-10,13-16H2,1H3,(H,31,32) |
| InChIKey | ZBWOFXIVGSLPPU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|