C22H34N2O3S — CID 126748275
tert-butyl 4-[3-tert-butylsulfanyl-2-(3-methyloxiran-2-yl)phenyl]piperazine-1-carboxylate (PubChem CID 126748275) has the molecular formula C22H34N2O3S and a molecular weight of 406.59 g/mol. Its IUPAC name is tert-butyl 4-[3-tert-butylsulfanyl-2-(3-methyloxiran-2-yl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-tert-butylsulfanyl-2-(3-methyloxiran-2-yl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 126748275 |
| Molecular Formula | C22H34N2O3S |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | tert-butyl 4-[3-tert-butylsulfanyl-2-(3-methyloxiran-2-yl)phenyl]piperazine-1-carboxylate |
| SMILES | CC1OC1c1c(SC(C)(C)C)cccc1N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H34N2O3S/c1-15-19(26-15)18-16(9-8-10-17(18)28-22(5,6)7)23-11-13-24(14-12-23)20(25)27-21(2,3)4/h8-10,15,19H,11-14H2,1-7H3 |
| InChIKey | DJNPEONVRVVCOR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 45.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|