C19H24N2O4 — CID 71484907
tert-butyl 4-(4-methyl-2-oxochromen-5-yl)piperazine-1-carboxylate (PubChem CID 71484907) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is tert-butyl 4-(4-methyl-2-oxochromen-5-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-methyl-2-oxochromen-5-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71484907 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | tert-butyl 4-(4-methyl-2-oxochromen-5-yl)piperazine-1-carboxylate |
| SMILES | Cc1cc(=O)oc2cccc(N3CCN(C(=O)OC(C)(C)C)CC3)c12 |
| InChI | InChI=1S/C19H24N2O4/c1-13-12-16(22)24-15-7-5-6-14(17(13)15)20-8-10-21(11-9-20)18(23)25-19(2,3)4/h5-7,12H,8-11H2,1-4H3 |
| InChIKey | PEYGMVDFEDCEHI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|