2-chloro-4,5-difluorothiophene-3-sulfonic acid

C4HClF2O3S2 — CID 126750006

IUPAC2-chloro-4,5-difluorothiophene-3-sulfonic acid
SMILESO=S(=O)(O)c1c(Cl)sc(F)c1F
InChIInChI=1S/C4HClF2O3S2/c5-3-2(12(8,9)10)1(6)4(7)11-3/h(H,8,9,10)
InChIKeyYEGJYIPUUNQABC-UHFFFAOYSA-N
MW234.63 g/mol
LogP1.93
Rot. Bonds1

About 2-chloro-4,5-difluorothiophene-3-sulfonic acid

2-chloro-4,5-difluorothiophene-3-sulfonic acid (PubChem CID 126750006) has the molecular formula C4HClF2O3S2 and a molecular weight of 234.63 g/mol. Its IUPAC name is 2-chloro-4,5-difluorothiophene-3-sulfonic acid.

Molecular Properties

Compound Name2-chloro-4,5-difluorothiophene-3-sulfonic acid
PubChem CID126750006
Molecular FormulaC4HClF2O3S2
Molecular Weight234.63 g/mol
Exact Mass233.90
IUPAC Name2-chloro-4,5-difluorothiophene-3-sulfonic acid
SMILESO=S(=O)(O)c1c(Cl)sc(F)c1F
InChIInChI=1S/C4HClF2O3S2/c5-3-2(12(8,9)10)1(6)4(7)11-3/h(H,8,9,10)
InChIKeyYEGJYIPUUNQABC-UHFFFAOYSA-N
XLogP1.93
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.63
LogP ≤ 51.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-chloro-4,5-difluorothiophene-3-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloro-4,5-difluorothiophene-3-sulfonic acid?
The IUPAC name of 2-chloro-4,5-difluorothiophene-3-sulfonic acid (CID 126750006) is 2-chloro-4,5-difluorothiophene-3-sulfonic acid.
What is the SMILES notation for 2-chloro-4,5-difluorothiophene-3-sulfonic acid?
The canonical SMILES for 2-chloro-4,5-difluorothiophene-3-sulfonic acid is O=S(=O)(O)c1c(Cl)sc(F)c1F.
What is the InChIKey of 2-chloro-4,5-difluorothiophene-3-sulfonic acid?
The InChIKey is YEGJYIPUUNQABC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HClF2O3S2/c5-3-2(12(8,9)10)1(6)4(7)11-3/h(H,8,9,10).
What are the key properties of 2-chloro-4,5-difluorothiophene-3-sulfonic acid?
2-chloro-4,5-difluorothiophene-3-sulfonic acid has a molecular weight of 234.63 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,5-difluorothiophene-3-sulfonic acid is sourced from PubChem (CID 126750006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).