C24H29ClO4 — CID 126752223
[6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-prop-2-enoxyoxan-2-yl]methanol (PubChem CID 126752223) has the molecular formula C24H29ClO4 and a molecular weight of 416.95 g/mol. Its IUPAC name is [6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-prop-2-enoxyoxan-2-yl]methanol.
| Compound Name | [6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-prop-2-enoxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 126752223 |
| Molecular Formula | C24H29ClO4 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | [6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-prop-2-enoxyoxan-2-yl]methanol |
| SMILES | C=CCOC1(c2ccc(Cl)c(Cc3ccc(OCC)cc3)c2)CCCC(CO)O1 |
| InChI | InChI=1S/C24H29ClO4/c1-3-14-28-24(13-5-6-22(17-26)29-24)20-9-12-23(25)19(16-20)15-18-7-10-21(11-8-18)27-4-2/h3,7-12,16,22,26H,1,4-6,13-15,17H2,2H3 |
| InChIKey | PTZWJEVZDRMUKW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|