C19H20N3O6PS — CID 126755018
[4-[[3-propan-2-yloxy-5-(1,3,4-thiadiazol-2-ylcarbamoyl)phenoxy]methyl]phenyl]phosphonic acid (PubChem CID 126755018) has the molecular formula C19H20N3O6PS and a molecular weight of 449.43 g/mol. Its IUPAC name is [4-[[3-propan-2-yloxy-5-(1,3,4-thiadiazol-2-ylcarbamoyl)phenoxy]methyl]phenyl]phosphonic acid.
| Compound Name | [4-[[3-propan-2-yloxy-5-(1,3,4-thiadiazol-2-ylcarbamoyl)phenoxy]methyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 126755018 |
| Molecular Formula | C19H20N3O6PS |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | [4-[[3-propan-2-yloxy-5-(1,3,4-thiadiazol-2-ylcarbamoyl)phenoxy]methyl]phenyl]phosphonic acid |
| SMILES | CC(C)Oc1cc(OCc2ccc(P(=O)(O)O)cc2)cc(C(=O)Nc2nncs2)c1 |
| InChI | InChI=1S/C19H20N3O6PS/c1-12(2)28-16-8-14(18(23)21-19-22-20-11-30-19)7-15(9-16)27-10-13-3-5-17(6-4-13)29(24,25)26/h3-9,11-12H,10H2,1-2H3,(H,21,22,23)(H2,24,25,26) |
| InChIKey | LFZDPGZVGQTQCY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|