C29H44S2 — CID 126755860
2,6-ditert-butyl-3,7,8-trimethyl-4-octylthieno[2,3-f][1]benzothiole (PubChem CID 126755860) has the molecular formula C29H44S2 and a molecular weight of 456.81 g/mol. Its IUPAC name is 2,6-ditert-butyl-3,7,8-trimethyl-4-octylthieno[2,3-f][1]benzothiole.
| Compound Name | 2,6-ditert-butyl-3,7,8-trimethyl-4-octylthieno[2,3-f][1]benzothiole |
|---|---|
| PubChem CID | 126755860 |
| Molecular Formula | C29H44S2 |
| Molecular Weight | 456.81 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 2,6-ditert-butyl-3,7,8-trimethyl-4-octylthieno[2,3-f][1]benzothiole |
| SMILES | CCCCCCCCc1c2sc(C(C)(C)C)c(C)c2c(C)c2sc(C(C)(C)C)c(C)c12 |
| InChI | InChI=1S/C29H44S2/c1-11-12-13-14-15-16-17-21-23-20(4)27(29(8,9)10)30-24(23)18(2)22-19(3)26(28(5,6)7)31-25(21)22/h11-17H2,1-10H3 |
| InChIKey | NTFOHQAFECBSQX-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.81 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|