C15H17BrFN3OS — CID 126757163
N'-[(1R)-1-(2-bromo-4-fluorophenyl)ethyl]-N-(1-methoxyethyl)-1,3-thiazole-2-carboximidamide (PubChem CID 126757163) has the molecular formula C15H17BrFN3OS and a molecular weight of 386.29 g/mol. Its IUPAC name is N'-[(1R)-1-(2-bromo-4-fluorophenyl)ethyl]-N-(1-methoxyethyl)-1,3-thiazole-2-carboximidamide.
| Compound Name | N'-[(1R)-1-(2-bromo-4-fluorophenyl)ethyl]-N-(1-methoxyethyl)-1,3-thiazole-2-carboximidamide |
|---|---|
| PubChem CID | 126757163 |
| Molecular Formula | C15H17BrFN3OS |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | N'-[(1R)-1-(2-bromo-4-fluorophenyl)ethyl]-N-(1-methoxyethyl)-1,3-thiazole-2-carboximidamide |
| SMILES | COC(C)N/C(=N\[C@H](C)c1ccc(F)cc1Br)c1nccs1 |
| InChI | InChI=1S/C15H17BrFN3OS/c1-9(12-5-4-11(17)8-13(12)16)19-14(20-10(2)21-3)15-18-6-7-22-15/h4-10H,1-3H3,(H,19,20)/t9-,10?/m1/s1 |
| InChIKey | RPRAGMZBWXTSKZ-YHMJZVADSA-N |
| XLogP | 4.13 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|