C24H24N4O2S — CID 126761159
(E)-3-[1-[[2-(cyclohexylamino)-1,3-benzothiazol-6-yl]methyl]benzimidazol-5-yl]prop-2-enoic acid (PubChem CID 126761159) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is (E)-3-[1-[[2-(cyclohexylamino)-1,3-benzothiazol-6-yl]methyl]benzimidazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[[2-(cyclohexylamino)-1,3-benzothiazol-6-yl]methyl]benzimidazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 126761159 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (E)-3-[1-[[2-(cyclohexylamino)-1,3-benzothiazol-6-yl]methyl]benzimidazol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc2c(c1)ncn2Cc1ccc2nc(NC3CCCCC3)sc2c1 |
| InChI | InChI=1S/C24H24N4O2S/c29-23(30)11-8-16-7-10-21-20(12-16)25-15-28(21)14-17-6-9-19-22(13-17)31-24(27-19)26-18-4-2-1-3-5-18/h6-13,15,18H,1-5,14H2,(H,26,27)(H,29,30)/b11-8+ |
| InChIKey | WEZPEWOIUFHFPY-DHZHZOJOSA-N |
| XLogP | 5.54 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|