C18H27ClN2 — CID 126763120
N-[(4-chlorophenyl)methyl]-1-methyl-N-[(Z)-pent-2-en-2-yl]piperidin-4-amine (PubChem CID 126763120) has the molecular formula C18H27ClN2 and a molecular weight of 306.88 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-1-methyl-N-[(Z)-pent-2-en-2-yl]piperidin-4-amine.
| Compound Name | N-[(4-chlorophenyl)methyl]-1-methyl-N-[(Z)-pent-2-en-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 126763120 |
| Molecular Formula | C18H27ClN2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-1-methyl-N-[(Z)-pent-2-en-2-yl]piperidin-4-amine |
| SMILES | CC/C=C(/C)N(Cc1ccc(Cl)cc1)C1CCN(C)CC1 |
| InChI | InChI=1S/C18H27ClN2/c1-4-5-15(2)21(18-10-12-20(3)13-11-18)14-16-6-8-17(19)9-7-16/h5-9,18H,4,10-14H2,1-3H3/b15-5- |
| InChIKey | XILHSSWWKMBVCI-WCSRMQSCSA-N |
| XLogP | 4.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |