C17H28ClNO2 — CID 143607146
1-(4-chlorophenyl)propan-2-one;ethane;1-methylpiperidin-4-ol (PubChem CID 143607146) has the molecular formula C17H28ClNO2 and a molecular weight of 313.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)propan-2-one;ethane;1-methylpiperidin-4-ol.
| Compound Name | 1-(4-chlorophenyl)propan-2-one;ethane;1-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 143607146 |
| Molecular Formula | C17H28ClNO2 |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-(4-chlorophenyl)propan-2-one;ethane;1-methylpiperidin-4-ol |
| SMILES | CC.CC(=O)Cc1ccc(Cl)cc1.CN1CCC(O)CC1 |
| InChI | InChI=1S/C9H9ClO.C6H13NO.C2H6/c1-7(11)6-8-2-4-9(10)5-3-8;1-7-4-2-6(8)3-5-7;1-2/h2-5H,6H2,1H3;6,8H,2-5H2,1H3;1-2H3 |
| InChIKey | NDJQWKVWMHATSI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |