C20H20N2O6 — CID 126763359
[3-formyl-2-hydroxy-5-[3-(4-methylpiperazine-1-carbonyl)phenyl]phenyl] hydrogen carbonate (PubChem CID 126763359) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is [3-formyl-2-hydroxy-5-[3-(4-methylpiperazine-1-carbonyl)phenyl]phenyl] hydrogen carbonate.
| Compound Name | [3-formyl-2-hydroxy-5-[3-(4-methylpiperazine-1-carbonyl)phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 126763359 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | [3-formyl-2-hydroxy-5-[3-(4-methylpiperazine-1-carbonyl)phenyl]phenyl] hydrogen carbonate |
| SMILES | CN1CCN(C(=O)c2cccc(-c3cc(C=O)c(O)c(OC(=O)O)c3)c2)CC1 |
| InChI | InChI=1S/C20H20N2O6/c1-21-5-7-22(8-6-21)19(25)14-4-2-3-13(9-14)15-10-16(12-23)18(24)17(11-15)28-20(26)27/h2-4,9-12,24H,5-8H2,1H3,(H,26,27) |
| InChIKey | GEJDVBDXCLILBX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|