C36H35NO9 — CID 74983308
N-cyclohexyl-3-(3-formyl-4-hydroxy-5-methoxyphenyl)benzamide;3-(3-formyl-4-hydroxy-5-methoxyphenyl)benzoic acid (PubChem CID 74983308) has the molecular formula C36H35NO9 and a molecular weight of 625.67 g/mol. Its IUPAC name is N-cyclohexyl-3-(3-formyl-4-hydroxy-5-methoxyphenyl)benzamide;3-(3-formyl-4-hydroxy-5-methoxyphenyl)benzoic acid.
| Compound Name | N-cyclohexyl-3-(3-formyl-4-hydroxy-5-methoxyphenyl)benzamide;3-(3-formyl-4-hydroxy-5-methoxyphenyl)benzoic acid |
|---|---|
| PubChem CID | 74983308 |
| Molecular Formula | C36H35NO9 |
| Molecular Weight | 625.67 g/mol |
| Exact Mass | 625.23 |
| IUPAC Name | N-cyclohexyl-3-(3-formyl-4-hydroxy-5-methoxyphenyl)benzamide;3-(3-formyl-4-hydroxy-5-methoxyphenyl)benzoic acid |
| SMILES | COc1cc(-c2cccc(C(=O)NC3CCCCC3)c2)cc(C=O)c1O.COc1cc(-c2cccc(C(=O)O)c2)cc(C=O)c1O |
| InChI | InChI=1S/C21H23NO4.C15H12O5/c1-26-19-12-16(11-17(13-23)20(19)24)14-6-5-7-15(10-14)21(25)22-18-8-3-2-4-9-18;1-20-13-7-11(6-12(8-16)14(13)17)9-3-2-4-10(5-9)15(18)19/h5-7,10-13,18,24H,2-4,8-9H2,1H3,(H,22,25);2-8,17H,1H3,(H,18,19) |
| InChIKey | DQKCTQZPVWGBBZ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.67 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|