C19H29NO — CID 126764258
[3-(2,2-dimethylpentyl)phenyl]-piperidin-1-ylmethanone (PubChem CID 126764258) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is [3-(2,2-dimethylpentyl)phenyl]-piperidin-1-ylmethanone.
| Compound Name | [3-(2,2-dimethylpentyl)phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 126764258 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | [3-(2,2-dimethylpentyl)phenyl]-piperidin-1-ylmethanone |
| SMILES | CCCC(C)(C)Cc1cccc(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H29NO/c1-4-11-19(2,3)15-16-9-8-10-17(14-16)18(21)20-12-6-5-7-13-20/h8-10,14H,4-7,11-13,15H2,1-3H3 |
| InChIKey | GSUHCCCYVORZRT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |