C11H14FNO — CID 126768514
cyclopent-3-en-1-yl-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 126768514) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | cyclopent-3-en-1-yl-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 126768514 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | cyclopent-3-en-1-yl-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | O=C(C1CC=CC1)N1CCC=C(F)C1 |
| InChI | InChI=1S/C11H14FNO/c12-10-6-3-7-13(8-10)11(14)9-4-1-2-5-9/h1-2,6,9H,3-5,7-8H2 |
| InChIKey | JIORCRBZMXRWQM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|