C16H24FNO — CID 170392260
2-ethyl-4-fluoro-1-[3-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-2,5-dihydropyrrol-1-yl]butan-1-one (PubChem CID 170392260) has the molecular formula C16H24FNO and a molecular weight of 265.37 g/mol. Its IUPAC name is 2-ethyl-4-fluoro-1-[3-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-2,5-dihydropyrrol-1-yl]butan-1-one.
| Compound Name | 2-ethyl-4-fluoro-1-[3-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-2,5-dihydropyrrol-1-yl]butan-1-one |
|---|---|
| PubChem CID | 170392260 |
| Molecular Formula | C16H24FNO |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2-ethyl-4-fluoro-1-[3-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-2,5-dihydropyrrol-1-yl]butan-1-one |
| SMILES | C/C=C\C(C)=C/C1=CCN(C(=O)C(CC)CCF)C1 |
| InChI | InChI=1S/C16H24FNO/c1-4-6-13(3)11-14-8-10-18(12-14)16(19)15(5-2)7-9-17/h4,6,8,11,15H,5,7,9-10,12H2,1-3H3/b6-4-,13-11- |
| InChIKey | LLTURFGGVHAUMP-NHDWVQLVSA-N |
| XLogP | 3.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|