C10H16FNO — CID 130679998
1-(3,6-dihydro-2H-pyridin-1-yl)-2-fluoro-3-methylbutan-1-one (PubChem CID 130679998) has the molecular formula C10H16FNO and a molecular weight of 185.24 g/mol. Its IUPAC name is 1-(3,6-dihydro-2H-pyridin-1-yl)-2-fluoro-3-methylbutan-1-one.
| Compound Name | 1-(3,6-dihydro-2H-pyridin-1-yl)-2-fluoro-3-methylbutan-1-one |
|---|---|
| PubChem CID | 130679998 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 1-(3,6-dihydro-2H-pyridin-1-yl)-2-fluoro-3-methylbutan-1-one |
| SMILES | CC(C)C(F)C(=O)N1CC=CCC1 |
| InChI | InChI=1S/C10H16FNO/c1-8(2)9(11)10(13)12-6-4-3-5-7-12/h3-4,8-9H,5-7H2,1-2H3 |
| InChIKey | ZLGWJBUCBGQWBK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|