C10H13FN2OS — CID 126769914
3-[[(3-fluoro-2-pyridinyl)amino]methyl]thiolan-3-ol (PubChem CID 126769914) has the molecular formula C10H13FN2OS and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-[[(3-fluoro-2-pyridinyl)amino]methyl]thiolan-3-ol.
| Compound Name | 3-[[(3-fluoro-2-pyridinyl)amino]methyl]thiolan-3-ol |
|---|---|
| PubChem CID | 126769914 |
| Molecular Formula | C10H13FN2OS |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 3-[[(3-fluoro-2-pyridinyl)amino]methyl]thiolan-3-ol |
| SMILES | OC1(CNc2ncccc2F)CCSC1 |
| InChI | InChI=1S/C10H13FN2OS/c11-8-2-1-4-12-9(8)13-6-10(14)3-5-15-7-10/h1-2,4,14H,3,5-7H2,(H,12,13) |
| InChIKey | UGNXIEGUJUYDAF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |