C13H20N2O5 — CID 12677009
ethyl 1-(2-ethoxy-2-oxoethyl)-5-(1-hydroxyethyl)-3-methylpyrazole-4-carboxylate (PubChem CID 12677009) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is ethyl 1-(2-ethoxy-2-oxoethyl)-5-(1-hydroxyethyl)-3-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 1-(2-ethoxy-2-oxoethyl)-5-(1-hydroxyethyl)-3-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 12677009 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | ethyl 1-(2-ethoxy-2-oxoethyl)-5-(1-hydroxyethyl)-3-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)Cn1nc(C)c(C(=O)OCC)c1C(C)O |
| InChI | InChI=1S/C13H20N2O5/c1-5-19-10(17)7-15-12(9(4)16)11(8(3)14-15)13(18)20-6-2/h9,16H,5-7H2,1-4H3 |
| InChIKey | YXEGLKRXQVCWTR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |