C16H18N4O — CID 126771991
4-amino-N-[[1-(2-methylphenyl)cyclopropyl]methyl]pyrimidine-5-carboxamide (PubChem CID 126771991) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 4-amino-N-[[1-(2-methylphenyl)cyclopropyl]methyl]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-N-[[1-(2-methylphenyl)cyclopropyl]methyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 126771991 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-amino-N-[[1-(2-methylphenyl)cyclopropyl]methyl]pyrimidine-5-carboxamide |
| SMILES | Cc1ccccc1C1(CNC(=O)c2cncnc2N)CC1 |
| InChI | InChI=1S/C16H18N4O/c1-11-4-2-3-5-13(11)16(6-7-16)9-19-15(21)12-8-18-10-20-14(12)17/h2-5,8,10H,6-7,9H2,1H3,(H,19,21)(H2,17,18,20) |
| InChIKey | FOIBDGRYGKFROT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |