C17H16N2O2S — CID 126774127
2-(oxolan-2-yl)-4-(quinolin-8-yloxymethyl)-1,3-thiazole (PubChem CID 126774127) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-(oxolan-2-yl)-4-(quinolin-8-yloxymethyl)-1,3-thiazole.
| Compound Name | 2-(oxolan-2-yl)-4-(quinolin-8-yloxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 126774127 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-(oxolan-2-yl)-4-(quinolin-8-yloxymethyl)-1,3-thiazole |
| SMILES | c1cnc2c(OCc3csc(C4CCCO4)n3)cccc2c1 |
| InChI | InChI=1S/C17H16N2O2S/c1-4-12-5-2-8-18-16(12)14(6-1)21-10-13-11-22-17(19-13)15-7-3-9-20-15/h1-2,4-6,8,11,15H,3,7,9-10H2 |
| InChIKey | PDSIOMHQTYQQDS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |