C9H12FN3OS — CID 126776448
(3-fluoro-3-methylpyrrolidin-1-yl)-(4-methylthiadiazol-5-yl)methanone (PubChem CID 126776448) has the molecular formula C9H12FN3OS and a molecular weight of 229.28 g/mol. Its IUPAC name is (3-fluoro-3-methylpyrrolidin-1-yl)-(4-methylthiadiazol-5-yl)methanone.
| Compound Name | (3-fluoro-3-methylpyrrolidin-1-yl)-(4-methylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 126776448 |
| Molecular Formula | C9H12FN3OS |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | (3-fluoro-3-methylpyrrolidin-1-yl)-(4-methylthiadiazol-5-yl)methanone |
| SMILES | Cc1nnsc1C(=O)N1CCC(C)(F)C1 |
| InChI | InChI=1S/C9H12FN3OS/c1-6-7(15-12-11-6)8(14)13-4-3-9(2,10)5-13/h3-5H2,1-2H3 |
| InChIKey | SBCWDLHXJDWXQB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |