C10H10F3N3O3S — CID 63708348
1-(4-methylthiadiazole-5-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 63708348) has the molecular formula C10H10F3N3O3S and a molecular weight of 309.27 g/mol. Its IUPAC name is 1-(4-methylthiadiazole-5-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(4-methylthiadiazole-5-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63708348 |
| Molecular Formula | C10H10F3N3O3S |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 1-(4-methylthiadiazole-5-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | Cc1nnsc1C(=O)N1CCC(C(=O)O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H10F3N3O3S/c1-5-6(20-15-14-5)7(17)16-3-2-9(4-16,8(18)19)10(11,12)13/h2-4H2,1H3,(H,18,19) |
| InChIKey | UWRTWSJOJSJZEU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |