C11H12F3N3O3S — CID 65205296
1-(4-ethylthiadiazole-5-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 65205296) has the molecular formula C11H12F3N3O3S and a molecular weight of 323.30 g/mol. Its IUPAC name is 1-(4-ethylthiadiazole-5-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(4-ethylthiadiazole-5-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 65205296 |
| Molecular Formula | C11H12F3N3O3S |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-(4-ethylthiadiazole-5-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCc1nnsc1C(=O)N1CCC(C(=O)O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H12F3N3O3S/c1-2-6-7(21-16-15-6)8(18)17-4-3-10(5-17,9(19)20)11(12,13)14/h2-5H2,1H3,(H,19,20) |
| InChIKey | JWCOQEAPUVSPDQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |