C11H17N3O3S — CID 60826961
3-[tert-butyl-(4-methylthiadiazole-5-carbonyl)amino]propanoic acid (PubChem CID 60826961) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 3-[tert-butyl-(4-methylthiadiazole-5-carbonyl)amino]propanoic acid.
| Compound Name | 3-[tert-butyl-(4-methylthiadiazole-5-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 60826961 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 3-[tert-butyl-(4-methylthiadiazole-5-carbonyl)amino]propanoic acid |
| SMILES | Cc1nnsc1C(=O)N(CCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H17N3O3S/c1-7-9(18-13-12-7)10(17)14(11(2,3)4)6-5-8(15)16/h5-6H2,1-4H3,(H,15,16) |
| InChIKey | VKUFEPMANPSTAO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |