C17H22N4O3S — CID 126776510
2-[[1-(2-methoxyphenyl)piperidin-4-yl]amino]pyridine-3-sulfonamide (PubChem CID 126776510) has the molecular formula C17H22N4O3S and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-[[1-(2-methoxyphenyl)piperidin-4-yl]amino]pyridine-3-sulfonamide.
| Compound Name | 2-[[1-(2-methoxyphenyl)piperidin-4-yl]amino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 126776510 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[[1-(2-methoxyphenyl)piperidin-4-yl]amino]pyridine-3-sulfonamide |
| SMILES | COc1ccccc1N1CCC(Nc2ncccc2S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C17H22N4O3S/c1-24-15-6-3-2-5-14(15)21-11-8-13(9-12-21)20-17-16(25(18,22)23)7-4-10-19-17/h2-7,10,13H,8-9,11-12H2,1H3,(H,19,20)(H2,18,22,23) |
| InChIKey | CGAJVSBHYLLSKY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |