C17H20Cl2N4O2S — CID 133453551
2-[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]pyridine-3-sulfonamide (PubChem CID 133453551) has the molecular formula C17H20Cl2N4O2S and a molecular weight of 415.35 g/mol. Its IUPAC name is 2-[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]pyridine-3-sulfonamide.
| Compound Name | 2-[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133453551 |
| Molecular Formula | C17H20Cl2N4O2S |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 2-[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cccnc1NC1CCN(Cc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H20Cl2N4O2S/c18-13-8-12(9-14(19)10-13)11-23-6-3-15(4-7-23)22-17-16(26(20,24)25)2-1-5-21-17/h1-2,5,8-10,15H,3-4,6-7,11H2,(H,21,22)(H2,20,24,25) |
| InChIKey | MFQQDTXKNARYNJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |