C17H20F3N5O2 — CID 126778659
1-[[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea (PubChem CID 126778659) has the molecular formula C17H20F3N5O2 and a molecular weight of 383.37 g/mol. Its IUPAC name is 1-[[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea.
| Compound Name | 1-[[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
|---|---|
| PubChem CID | 126778659 |
| Molecular Formula | C17H20F3N5O2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 1-[[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
| SMILES | Cc1ccc(CNC(=O)NC2CCc3ncnn3C2)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C17H20F3N5O2/c1-11-2-3-12(14(6-11)27-9-17(18,19)20)7-21-16(26)24-13-4-5-15-22-10-23-25(15)8-13/h2-3,6,10,13H,4-5,7-9H2,1H3,(H2,21,24,26) |
| InChIKey | ZYYXAMZKDHCELB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |