C16H19FN4O3 — CID 126779381
1-(2-fluorophenyl)-4-hydroxy-N-[(4-methylmorpholin-2-yl)methyl]pyrazole-3-carboxamide (PubChem CID 126779381) has the molecular formula C16H19FN4O3 and a molecular weight of 334.35 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-hydroxy-N-[(4-methylmorpholin-2-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-4-hydroxy-N-[(4-methylmorpholin-2-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 126779381 |
| Molecular Formula | C16H19FN4O3 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-(2-fluorophenyl)-4-hydroxy-N-[(4-methylmorpholin-2-yl)methyl]pyrazole-3-carboxamide |
| SMILES | CN1CCOC(CNC(=O)c2nn(-c3ccccc3F)cc2O)C1 |
| InChI | InChI=1S/C16H19FN4O3/c1-20-6-7-24-11(9-20)8-18-16(23)15-14(22)10-21(19-15)13-5-3-2-4-12(13)17/h2-5,10-11,22H,6-9H2,1H3,(H,18,23) |
| InChIKey | BUVMQJRVHFGGEP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |