C10H10ClFN2O — CID 126782155
3-(4-chloro-3-fluoroanilino)pyrrolidin-2-one (PubChem CID 126782155) has the molecular formula C10H10ClFN2O and a molecular weight of 228.65 g/mol. Its IUPAC name is 3-(4-chloro-3-fluoroanilino)pyrrolidin-2-one.
| Compound Name | 3-(4-chloro-3-fluoroanilino)pyrrolidin-2-one |
|---|---|
| PubChem CID | 126782155 |
| Molecular Formula | C10H10ClFN2O |
| Molecular Weight | 228.65 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 3-(4-chloro-3-fluoroanilino)pyrrolidin-2-one |
| SMILES | O=C1NCCC1Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C10H10ClFN2O/c11-7-2-1-6(5-8(7)12)14-9-3-4-13-10(9)15/h1-2,5,9,14H,3-4H2,(H,13,15) |
| InChIKey | KSLOXDSLCPZTHE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.65 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |