C15H20BrClN2O — CID 126782966
3-(4-bromophenyl)-1-(3,5-dimethylpiperazin-1-yl)prop-2-en-1-one;hydrochloride (PubChem CID 126782966) has the molecular formula C15H20BrClN2O and a molecular weight of 359.70 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-(3,5-dimethylpiperazin-1-yl)prop-2-en-1-one;hydrochloride.
| Compound Name | 3-(4-bromophenyl)-1-(3,5-dimethylpiperazin-1-yl)prop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 126782966 |
| Molecular Formula | C15H20BrClN2O |
| Molecular Weight | 359.70 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 3-(4-bromophenyl)-1-(3,5-dimethylpiperazin-1-yl)prop-2-en-1-one;hydrochloride |
| SMILES | CC1CN(C(=O)C=Cc2ccc(Br)cc2)CC(C)N1.Cl |
| InChI | InChI=1S/C15H19BrN2O.ClH/c1-11-9-18(10-12(2)17-11)15(19)8-5-13-3-6-14(16)7-4-13;/h3-8,11-12,17H,9-10H2,1-2H3;1H |
| InChIKey | HRJUZQXXRWRSPX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.70 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|