C19H25N3O3 — CID 44555326
(E)-N-hydroxy-3-[4-[(E)-3-oxo-3-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]prop-1-enyl]phenyl]prop-2-enamide (PubChem CID 44555326) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[4-[(E)-3-oxo-3-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]prop-1-enyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[4-[(E)-3-oxo-3-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]prop-1-enyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 44555326 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (E)-N-hydroxy-3-[4-[(E)-3-oxo-3-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]prop-1-enyl]phenyl]prop-2-enamide |
| SMILES | C[C@@H]1CN(C(=O)/C=C/c2ccc(/C=C/C(=O)NO)cc2)C[C@H](C)N1C |
| InChI | InChI=1S/C19H25N3O3/c1-14-12-22(13-15(2)21(14)3)19(24)11-9-17-6-4-16(5-7-17)8-10-18(23)20-25/h4-11,14-15,25H,12-13H2,1-3H3,(H,20,23)/b10-8+,11-9+/t14-,15+ |
| InChIKey | KIIRSYGOPQUUMN-RUXRWUEWSA-N |
| XLogP | 1.77 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|