C19H20N2O3S — CID 126783071
N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide (PubChem CID 126783071) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide.
| Compound Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide |
|---|---|
| PubChem CID | 126783071 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide |
| SMILES | O=C1CCCc2cc(S(=O)(=O)NCC3Cc4ccccc43)ccc2N1 |
| InChI | InChI=1S/C19H20N2O3S/c22-19-7-3-5-14-11-16(8-9-18(14)21-19)25(23,24)20-12-15-10-13-4-1-2-6-17(13)15/h1-2,4,6,8-9,11,15,20H,3,5,7,10,12H2,(H,21,22) |
| InChIKey | YNXIFUCMZGPQTC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |