C17H23N5OS — CID 126783388
1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-3-(4,5,6,7-tetrahydro-1H-indazol-5-yl)urea (PubChem CID 126783388) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-3-(4,5,6,7-tetrahydro-1H-indazol-5-yl)urea.
| Compound Name | 1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-3-(4,5,6,7-tetrahydro-1H-indazol-5-yl)urea |
|---|---|
| PubChem CID | 126783388 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-3-(4,5,6,7-tetrahydro-1H-indazol-5-yl)urea |
| SMILES | CN(Cc1nc2c(s1)CCCC2)C(=O)NC1CCc2[nH]ncc2C1 |
| InChI | InChI=1S/C17H23N5OS/c1-22(10-16-20-14-4-2-3-5-15(14)24-16)17(23)19-12-6-7-13-11(8-12)9-18-21-13/h9,12H,2-8,10H2,1H3,(H,18,21)(H,19,23) |
| InChIKey | VEUHORTYKLSNQN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |