C11H20FNO2 — CID 126784432
6-(3-fluorobutyl)-2,9-dioxa-6-azaspiro[4.5]decane (PubChem CID 126784432) has the molecular formula C11H20FNO2 and a molecular weight of 217.28 g/mol. Its IUPAC name is 6-(3-fluorobutyl)-2,9-dioxa-6-azaspiro[4.5]decane.
| Compound Name | 6-(3-fluorobutyl)-2,9-dioxa-6-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 126784432 |
| Molecular Formula | C11H20FNO2 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 6-(3-fluorobutyl)-2,9-dioxa-6-azaspiro[4.5]decane |
| SMILES | CC(F)CCN1CCOCC12CCOC2 |
| InChI | InChI=1S/C11H20FNO2/c1-10(12)2-4-13-5-7-15-9-11(13)3-6-14-8-11/h10H,2-9H2,1H3 |
| InChIKey | RCXOWWNNPJEQQN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |