C17H25NO2 — CID 129430000
(5R)-6-[(3R)-3-phenylbutyl]-2,9-dioxa-6-azaspiro[4.5]decane (PubChem CID 129430000) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (5R)-6-[(3R)-3-phenylbutyl]-2,9-dioxa-6-azaspiro[4.5]decane.
| Compound Name | (5R)-6-[(3R)-3-phenylbutyl]-2,9-dioxa-6-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 129430000 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (5R)-6-[(3R)-3-phenylbutyl]-2,9-dioxa-6-azaspiro[4.5]decane |
| SMILES | C[C@H](CCN1CCOC[C@]12CCOC2)c1ccccc1 |
| InChI | InChI=1S/C17H25NO2/c1-15(16-5-3-2-4-6-16)7-9-18-10-12-20-14-17(18)8-11-19-13-17/h2-6,15H,7-14H2,1H3/t15-,17-/m1/s1 |
| InChIKey | BWWAZDMPKBZJHE-NVXWUHKLSA-N |
| XLogP | 2.67 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |