C9H11F2N3 — CID 126784896
N-[(3,3-difluorocyclobutyl)methyl]pyrazin-2-amine (PubChem CID 126784896) has the molecular formula C9H11F2N3 and a molecular weight of 199.20 g/mol. Its IUPAC name is N-[(3,3-difluorocyclobutyl)methyl]pyrazin-2-amine.
| Compound Name | N-[(3,3-difluorocyclobutyl)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 126784896 |
| Molecular Formula | C9H11F2N3 |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | N-[(3,3-difluorocyclobutyl)methyl]pyrazin-2-amine |
| SMILES | FC1(F)CC(CNc2cnccn2)C1 |
| InChI | InChI=1S/C9H11F2N3/c10-9(11)3-7(4-9)5-14-8-6-12-1-2-13-8/h1-2,6-7H,3-5H2,(H,13,14) |
| InChIKey | DGQQINWIPJFBLQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |