C20H21N3O4S — CID 126785292
3-[(2-ethyl-4-oxo-1H-quinolin-6-yl)sulfamoyl]-N,N-dimethylbenzamide (PubChem CID 126785292) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 3-[(2-ethyl-4-oxo-1H-quinolin-6-yl)sulfamoyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[(2-ethyl-4-oxo-1H-quinolin-6-yl)sulfamoyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 126785292 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-[(2-ethyl-4-oxo-1H-quinolin-6-yl)sulfamoyl]-N,N-dimethylbenzamide |
| SMILES | CCc1cc(=O)c2cc(NS(=O)(=O)c3cccc(C(=O)N(C)C)c3)ccc2[nH]1 |
| InChI | InChI=1S/C20H21N3O4S/c1-4-14-12-19(24)17-11-15(8-9-18(17)21-14)22-28(26,27)16-7-5-6-13(10-16)20(25)23(2)3/h5-12,22H,4H2,1-3H3,(H,21,24) |
| InChIKey | GGPBPKCHAAWNEP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |