C23H33N3O2 — CID 126786259
1-[1-(1-benzofuran-2-yl)ethyl]-3-(1-cyclohexylpiperidin-4-yl)-1-methylurea (PubChem CID 126786259) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-[1-(1-benzofuran-2-yl)ethyl]-3-(1-cyclohexylpiperidin-4-yl)-1-methylurea.
| Compound Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-(1-cyclohexylpiperidin-4-yl)-1-methylurea |
|---|---|
| PubChem CID | 126786259 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-(1-cyclohexylpiperidin-4-yl)-1-methylurea |
| SMILES | CC(c1cc2ccccc2o1)N(C)C(=O)NC1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C23H33N3O2/c1-17(22-16-18-8-6-7-11-21(18)28-22)25(2)23(27)24-19-12-14-26(15-13-19)20-9-4-3-5-10-20/h6-8,11,16-17,19-20H,3-5,9-10,12-15H2,1-2H3,(H,24,27) |
| InChIKey | SZPNCLITCCLBQW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |