C18H22N2O4 — CID 126786563
2-methyl-3-[methyl-[3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoyl]amino]propanoic acid (PubChem CID 126786563) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-[3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 126786563 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-methyl-3-[methyl-[3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoyl]amino]propanoic acid |
| SMILES | CC(CN(C)C(=O)C=Cc1ccc(N2CCCC2=O)cc1)C(=O)O |
| InChI | InChI=1S/C18H22N2O4/c1-13(18(23)24)12-19(2)16(21)10-7-14-5-8-15(9-6-14)20-11-3-4-17(20)22/h5-10,13H,3-4,11-12H2,1-2H3,(H,23,24) |
| InChIKey | KAOVNMYDQGDSRE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|